C17H24N2O — CID 28618409
1-[(2R)-1-ethylpyrrolidin-2-yl]-N-[(2-prop-2-ynoxyphenyl)methyl]methanamine (PubChem CID 28618409) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 1-[(2R)-1-ethylpyrrolidin-2-yl]-N-[(2-prop-2-ynoxyphenyl)methyl]methanamine.
| Compound Name | 1-[(2R)-1-ethylpyrrolidin-2-yl]-N-[(2-prop-2-ynoxyphenyl)methyl]methanamine |
|---|---|
| PubChem CID | 28618409 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 1-[(2R)-1-ethylpyrrolidin-2-yl]-N-[(2-prop-2-ynoxyphenyl)methyl]methanamine |
| SMILES | C#CCOc1ccccc1CNC[C@H]1CCCN1CC |
| InChI | InChI=1S/C17H24N2O/c1-3-12-20-17-10-6-5-8-15(17)13-18-14-16-9-7-11-19(16)4-2/h1,5-6,8,10,16,18H,4,7,9,11-14H2,2H3/t16-/m1/s1 |
| InChIKey | RYBOBQDVOSOPDJ-MRXNPFEDSA-N |
| XLogP | 2.27 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|