C13H16F3N — CID 114472266
3-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]but-3-en-1-amine (PubChem CID 114472266) has the molecular formula C13H16F3N and a molecular weight of 243.27 g/mol. Its IUPAC name is 3-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]but-3-en-1-amine.
| Compound Name | 3-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]but-3-en-1-amine |
|---|---|
| PubChem CID | 114472266 |
| Molecular Formula | C13H16F3N |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 3-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]but-3-en-1-amine |
| SMILES | C=C(C)CCNCc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H16F3N/c1-10(2)7-8-17-9-11-5-3-4-6-12(11)13(14,15)16/h3-6,17H,1,7-9H2,2H3 |
| InChIKey | LPUXTULOVRZXCK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|