C14H21F3N2 — CID 62635384
N'-methyl-N'-propan-2-yl-N-[[2-(trifluoromethyl)phenyl]methyl]ethane-1,2-diamine (PubChem CID 62635384) has the molecular formula C14H21F3N2 and a molecular weight of 274.33 g/mol. Its IUPAC name is N'-methyl-N'-propan-2-yl-N-[[2-(trifluoromethyl)phenyl]methyl]ethane-1,2-diamine.
| Compound Name | N'-methyl-N'-propan-2-yl-N-[[2-(trifluoromethyl)phenyl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 62635384 |
| Molecular Formula | C14H21F3N2 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N'-methyl-N'-propan-2-yl-N-[[2-(trifluoromethyl)phenyl]methyl]ethane-1,2-diamine |
| SMILES | CC(C)N(C)CCNCc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H21F3N2/c1-11(2)19(3)9-8-18-10-12-6-4-5-7-13(12)14(15,16)17/h4-7,11,18H,8-10H2,1-3H3 |
| InChIKey | GHPPUXGMEYGIQV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|