C12H20N2O — CID 66407185
3-(cyclopropylmethoxy)-N-(1H-pyrrol-3-ylmethyl)propan-1-amine (PubChem CID 66407185) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is 3-(cyclopropylmethoxy)-N-(1H-pyrrol-3-ylmethyl)propan-1-amine.
| Compound Name | 3-(cyclopropylmethoxy)-N-(1H-pyrrol-3-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 66407185 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 3-(cyclopropylmethoxy)-N-(1H-pyrrol-3-ylmethyl)propan-1-amine |
| SMILES | c1cc(CNCCCOCC2CC2)c[nH]1 |
| InChI | InChI=1S/C12H20N2O/c1(7-15-10-11-2-3-11)5-13-8-12-4-6-14-9-12/h4,6,9,11,13-14H,1-3,5,7-8,10H2 |
| InChIKey | SWTRPWBJHSRKHF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|