C13H22N2O2 — CID 114098872
N-[[5-(aminomethyl)furan-2-yl]methyl]-3-(cyclopropylmethoxy)propan-1-amine (PubChem CID 114098872) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is N-[[5-(aminomethyl)furan-2-yl]methyl]-3-(cyclopropylmethoxy)propan-1-amine.
| Compound Name | N-[[5-(aminomethyl)furan-2-yl]methyl]-3-(cyclopropylmethoxy)propan-1-amine |
|---|---|
| PubChem CID | 114098872 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | N-[[5-(aminomethyl)furan-2-yl]methyl]-3-(cyclopropylmethoxy)propan-1-amine |
| SMILES | NCc1ccc(CNCCCOCC2CC2)o1 |
| InChI | InChI=1S/C13H22N2O2/c14-8-12-4-5-13(17-12)9-15-6-1-7-16-10-11-2-3-11/h4-5,11,15H,1-3,6-10,14H2 |
| InChIKey | MKZRDHQDSPKUIO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|