About 4-chloro-2-[(1,4-dioxan-2-ylmethylamino)methyl]-6-methoxyphenol
4-chloro-2-[(1,4-dioxan-2-ylmethylamino)methyl]-6-methoxyphenol (PubChem CID 104646147) has the molecular formula C13H18ClNO4
and a molecular weight of 287.74 g/mol. Its IUPAC name is 4-chloro-2-[(1,4-dioxan-2-ylmethylamino)methyl]-6-methoxyphenol.
Molecular Properties
| Compound Name | 4-chloro-2-[(1,4-dioxan-2-ylmethylamino)methyl]-6-methoxyphenol |
| PubChem CID | 104646147 |
| Molecular Formula | C13H18ClNO4 |
| Molecular Weight | 287.74 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 4-chloro-2-[(1,4-dioxan-2-ylmethylamino)methyl]-6-methoxyphenol |
| SMILES | COc1cc(Cl)cc(CNCC2COCCO2)c1O |
| InChI | InChI=1S/C13H18ClNO4/c1-17-12-5-10(14)4-9(13(12)16)6-15-7-11-8-18-2-3-19-11/h4-5,11,15-16H,2-3,6-8H2,1H3 |
| InChIKey | UMWGRNFBFOYFNA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.74 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-[(1,4-dioxan-2-ylmethylamino)methyl]-6-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-[(1,4-dioxan-2-ylmethylamino)methyl]-6-methoxyphenol?
The IUPAC name of 4-chloro-2-[(1,4-dioxan-2-ylmethylamino)methyl]-6-methoxyphenol (CID 104646147) is 4-chloro-2-[(1,4-dioxan-2-ylmethylamino)methyl]-6-methoxyphenol.
What is the SMILES notation for 4-chloro-2-[(1,4-dioxan-2-ylmethylamino)methyl]-6-methoxyphenol?
The canonical SMILES for 4-chloro-2-[(1,4-dioxan-2-ylmethylamino)methyl]-6-methoxyphenol is COc1cc(Cl)cc(CNCC2COCCO2)c1O.
What is the InChIKey of 4-chloro-2-[(1,4-dioxan-2-ylmethylamino)methyl]-6-methoxyphenol?
The InChIKey is UMWGRNFBFOYFNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18ClNO4/c1-17-12-5-10(14)4-9(13(12)16)6-15-7-11-8-18-2-3-19-11/h4-5,11,15-16H,2-3,6-8H2,1H3.
What are the key properties of 4-chloro-2-[(1,4-dioxan-2-ylmethylamino)methyl]-6-methoxyphenol?
4-chloro-2-[(1,4-dioxan-2-ylmethylamino)methyl]-6-methoxyphenol has a molecular weight of 287.74 g/mol, XLogP of 1.56, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-[(1,4-dioxan-2-ylmethylamino)methyl]-6-methoxyphenol is sourced from PubChem (CID 104646147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).