C13H18ClNO4 — CID 104646147
4-chloro-2-[(1,4-dioxan-2-ylmethylamino)methyl]-6-methoxyphenol (PubChem CID 104646147) has the molecular formula C13H18ClNO4 and a molecular weight of 287.74 g/mol. Its IUPAC name is 4-chloro-2-[(1,4-dioxan-2-ylmethylamino)methyl]-6-methoxyphenol.
| Compound Name | 4-chloro-2-[(1,4-dioxan-2-ylmethylamino)methyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 104646147 |
| Molecular Formula | C13H18ClNO4 |
| Molecular Weight | 287.74 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 4-chloro-2-[(1,4-dioxan-2-ylmethylamino)methyl]-6-methoxyphenol |
| SMILES | COc1cc(Cl)cc(CNCC2COCCO2)c1O |
| InChI | InChI=1S/C13H18ClNO4/c1-17-12-5-10(14)4-9(13(12)16)6-15-7-11-8-18-2-3-19-11/h4-5,11,15-16H,2-3,6-8H2,1H3 |
| InChIKey | UMWGRNFBFOYFNA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.74 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|