C16H25ClIN3O — CID 111305876
1-[(3-chlorophenyl)methyl]-3-ethyl-1-methyl-2-(oxolan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111305876) has the molecular formula C16H25ClIN3O and a molecular weight of 437.75 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-3-ethyl-1-methyl-2-(oxolan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[(3-chlorophenyl)methyl]-3-ethyl-1-methyl-2-(oxolan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111305876 |
| Molecular Formula | C16H25ClIN3O |
| Molecular Weight | 437.75 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-3-ethyl-1-methyl-2-(oxolan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCCO1)N(C)Cc1cccc(Cl)c1.I |
| InChI | InChI=1S/C16H24ClN3O.HI/c1-3-18-16(19-11-15-8-5-9-21-15)20(2)12-13-6-4-7-14(17)10-13;/h4,6-7,10,15H,3,5,8-9,11-12H2,1-2H3,(H,18,19);1H |
| InChIKey | WZVCUAMSHNMEFA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.75 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|