C18H29BrIN3OS — CID 109381441
3-[2-(4-bromophenyl)sulfanyl-2-methylpropyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109381441) has the molecular formula C18H29BrIN3OS and a molecular weight of 542.33 g/mol. Its IUPAC name is 3-[2-(4-bromophenyl)sulfanyl-2-methylpropyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 3-[2-(4-bromophenyl)sulfanyl-2-methylpropyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109381441 |
| Molecular Formula | C18H29BrIN3OS |
| Molecular Weight | 542.33 g/mol |
| Exact Mass | 541.03 |
| IUPAC Name | 3-[2-(4-bromophenyl)sulfanyl-2-methylpropyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCC(C)(C)Sc1ccc(Br)cc1)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C18H28BrN3OS.HI/c1-18(2,24-16-7-5-15(19)6-8-16)13-21-17(20-3)22(4)11-14-9-10-23-12-14;/h5-8,14H,9-13H2,1-4H3,(H,20,21);1H |
| InChIKey | XQRUGBMDQJVAEO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.33 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|