C18H34N4O — CID 109393964
3-(diethylamino)-N'-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-N-ethylpyrrolidine-1-carboximidamide (PubChem CID 109393964) has the molecular formula C18H34N4O and a molecular weight of 322.50 g/mol. Its IUPAC name is 3-(diethylamino)-N'-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-N-ethylpyrrolidine-1-carboximidamide.
| Compound Name | 3-(diethylamino)-N'-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-N-ethylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 109393964 |
| Molecular Formula | C18H34N4O |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | 3-(diethylamino)-N'-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-N-ethylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCC1=CCOCC1)N1CCC(N(CC)CC)C1 |
| InChI | InChI=1S/C18H34N4O/c1-4-19-18(20-11-7-16-9-13-23-14-10-16)22-12-8-17(15-22)21(5-2)6-3/h9,17H,4-8,10-15H2,1-3H3,(H,19,20) |
| InChIKey | JMFSUZAQMSUVJC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|