C20H36N4O — CID 109395668
N'-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-N-ethyl-3-(piperidin-1-ylmethyl)pyrrolidine-1-carboximidamide (PubChem CID 109395668) has the molecular formula C20H36N4O and a molecular weight of 348.54 g/mol. Its IUPAC name is N'-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-N-ethyl-3-(piperidin-1-ylmethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-N-ethyl-3-(piperidin-1-ylmethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 109395668 |
| Molecular Formula | C20H36N4O |
| Molecular Weight | 348.54 g/mol |
| Exact Mass | 348.29 |
| IUPAC Name | N'-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-N-ethyl-3-(piperidin-1-ylmethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCC1=CCOCC1)N1CCC(CN2CCCCC2)C1 |
| InChI | InChI=1S/C20H36N4O/c1-2-21-20(22-10-6-18-8-14-25-15-9-18)24-13-7-19(17-24)16-23-11-4-3-5-12-23/h8,19H,2-7,9-17H2,1H3,(H,21,22) |
| InChIKey | ZANSASLOKIAUHI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|