C18H26F3N7 — CID 109378337
N-ethyl-N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109378337) has the molecular formula C18H26F3N7 and a molecular weight of 397.45 g/mol. Its IUPAC name is N-ethyl-N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109378337 |
| Molecular Formula | C18H26F3N7 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | N-ethyl-N'-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1nnc2ccccn12)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H26F3N7/c1-3-22-17(27-12-10-26(11-13-27)14(2)18(19,20)21)23-8-7-16-25-24-15-6-4-5-9-28(15)16/h4-6,9,14H,3,7-8,10-13H2,1-2H3,(H,22,23) |
| InChIKey | NUMMQQIHULADBH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|