C17H27F3IN5 — CID 109376386
N-ethyl-N'-(2-pyridin-2-ylethyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109376386) has the molecular formula C17H27F3IN5 and a molecular weight of 485.34 g/mol. Its IUPAC name is N-ethyl-N'-(2-pyridin-2-ylethyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-(2-pyridin-2-ylethyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109376386 |
| Molecular Formula | C17H27F3IN5 |
| Molecular Weight | 485.34 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | N-ethyl-N'-(2-pyridin-2-ylethyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccccn1)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C17H26F3N5.HI/c1-3-21-16(23-9-7-15-6-4-5-8-22-15)25-12-10-24(11-13-25)14(2)17(18,19)20;/h4-6,8,14H,3,7,9-13H2,1-2H3,(H,21,23);1H |
| InChIKey | ORNOSSGIQVUGIU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|