C19H30F3IN4O2S — CID 109377208
N-ethyl-N'-[2-(4-methylsulfonylphenyl)ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109377208) has the molecular formula C19H30F3IN4O2S and a molecular weight of 562.44 g/mol. Its IUPAC name is N-ethyl-N'-[2-(4-methylsulfonylphenyl)ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[2-(4-methylsulfonylphenyl)ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109377208 |
| Molecular Formula | C19H30F3IN4O2S |
| Molecular Weight | 562.44 g/mol |
| Exact Mass | 562.11 |
| IUPAC Name | N-ethyl-N'-[2-(4-methylsulfonylphenyl)ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccc(S(C)(=O)=O)cc1)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C19H29F3N4O2S.HI/c1-4-23-18(26-13-11-25(12-14-26)15(2)19(20,21)22)24-10-9-16-5-7-17(8-6-16)29(3,27)28;/h5-8,15H,4,9-14H2,1-3H3,(H,23,24);1H |
| InChIKey | WZXBMZPDPMVQLK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|