C19H29F3N4O2 — CID 109377215
N-ethyl-N'-[2-(2-hydroxy-4-methoxyphenyl)ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109377215) has the molecular formula C19H29F3N4O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is N-ethyl-N'-[2-(2-hydroxy-4-methoxyphenyl)ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(2-hydroxy-4-methoxyphenyl)ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109377215 |
| Molecular Formula | C19H29F3N4O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | N-ethyl-N'-[2-(2-hydroxy-4-methoxyphenyl)ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1ccc(OC)cc1O)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H29F3N4O2/c1-4-23-18(24-8-7-15-5-6-16(28-3)13-17(15)27)26-11-9-25(10-12-26)14(2)19(20,21)22/h5-6,13-14,27H,4,7-12H2,1-3H3,(H,23,24) |
| InChIKey | YPYGWPXCQWSGQJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|