C19H30F3IN4O2 — CID 109376344
N'-[(3-ethoxy-4-hydroxyphenyl)methyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109376344) has the molecular formula C19H30F3IN4O2 and a molecular weight of 530.37 g/mol. Its IUPAC name is N'-[(3-ethoxy-4-hydroxyphenyl)methyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(3-ethoxy-4-hydroxyphenyl)methyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109376344 |
| Molecular Formula | C19H30F3IN4O2 |
| Molecular Weight | 530.37 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | N'-[(3-ethoxy-4-hydroxyphenyl)methyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(O)c(OCC)c1)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C19H29F3N4O2.HI/c1-4-23-18(24-13-15-6-7-16(27)17(12-15)28-5-2)26-10-8-25(9-11-26)14(3)19(20,21)22;/h6-7,12,14,27H,4-5,8-11,13H2,1-3H3,(H,23,24);1H |
| InChIKey | CSWQTBBXFLQHOK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|