C21H28F4N6 — CID 109379088
N-ethyl-N'-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109379088) has the molecular formula C21H28F4N6 and a molecular weight of 440.49 g/mol. Its IUPAC name is N-ethyl-N'-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109379088 |
| Molecular Formula | C21H28F4N6 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | N-ethyl-N'-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1ccn(-c2ccc(F)cc2)n1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C21H28F4N6/c1-3-26-20(30-14-12-29(13-15-30)16(2)21(23,24)25)27-10-8-18-9-11-31(28-18)19-6-4-17(22)5-7-19/h4-7,9,11,16H,3,8,10,12-15H2,1-2H3,(H,26,27) |
| InChIKey | SRGRLYWKAWNXJF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|