C22H32IN5 — CID 111238076
4-(2,3-dimethylphenyl)-N-ethyl-N'-(2-pyridin-2-ylethyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111238076) has the molecular formula C22H32IN5 and a molecular weight of 493.44 g/mol. Its IUPAC name is 4-(2,3-dimethylphenyl)-N-ethyl-N'-(2-pyridin-2-ylethyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(2,3-dimethylphenyl)-N-ethyl-N'-(2-pyridin-2-ylethyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111238076 |
| Molecular Formula | C22H32IN5 |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | 4-(2,3-dimethylphenyl)-N-ethyl-N'-(2-pyridin-2-ylethyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccccn1)N1CCN(c2cccc(C)c2C)CC1.I |
| InChI | InChI=1S/C22H31N5.HI/c1-4-23-22(25-13-11-20-9-5-6-12-24-20)27-16-14-26(15-17-27)21-10-7-8-18(2)19(21)3;/h5-10,12H,4,11,13-17H2,1-3H3,(H,23,25);1H |
| InChIKey | STJCZXMZXUBQOL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|