C21H34N4O2 — CID 111238067
methyl 5-[[[4-(2,3-dimethylphenyl)piperazin-1-yl]-(ethylamino)methylidene]amino]pentanoate (PubChem CID 111238067) has the molecular formula C21H34N4O2 and a molecular weight of 374.53 g/mol. Its IUPAC name is methyl 5-[[[4-(2,3-dimethylphenyl)piperazin-1-yl]-(ethylamino)methylidene]amino]pentanoate.
| Compound Name | methyl 5-[[[4-(2,3-dimethylphenyl)piperazin-1-yl]-(ethylamino)methylidene]amino]pentanoate |
|---|---|
| PubChem CID | 111238067 |
| Molecular Formula | C21H34N4O2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | methyl 5-[[[4-(2,3-dimethylphenyl)piperazin-1-yl]-(ethylamino)methylidene]amino]pentanoate |
| SMILES | CCN/C(=N\CCCCC(=O)OC)N1CCN(c2cccc(C)c2C)CC1 |
| InChI | InChI=1S/C21H34N4O2/c1-5-22-21(23-12-7-6-11-20(26)27-4)25-15-13-24(14-16-25)19-10-8-9-17(2)18(19)3/h8-10H,5-7,11-16H2,1-4H3,(H,22,23) |
| InChIKey | PXTUMWCVAWLCGM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|