C21H36IN5O — CID 111238120
N-[2-[[[4-(2,3-dimethylphenyl)piperazin-1-yl]-(ethylamino)methylidene]amino]ethyl]-2-methylpropanamide;hydroiodide (PubChem CID 111238120) has the molecular formula C21H36IN5O and a molecular weight of 501.46 g/mol. Its IUPAC name is N-[2-[[[4-(2,3-dimethylphenyl)piperazin-1-yl]-(ethylamino)methylidene]amino]ethyl]-2-methylpropanamide;hydroiodide.
| Compound Name | N-[2-[[[4-(2,3-dimethylphenyl)piperazin-1-yl]-(ethylamino)methylidene]amino]ethyl]-2-methylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111238120 |
| Molecular Formula | C21H36IN5O |
| Molecular Weight | 501.46 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | N-[2-[[[4-(2,3-dimethylphenyl)piperazin-1-yl]-(ethylamino)methylidene]amino]ethyl]-2-methylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)C(C)C)N1CCN(c2cccc(C)c2C)CC1.I |
| InChI | InChI=1S/C21H35N5O.HI/c1-6-22-21(24-11-10-23-20(27)16(2)3)26-14-12-25(13-15-26)19-9-7-8-17(4)18(19)5;/h7-9,16H,6,10-15H2,1-5H3,(H,22,24)(H,23,27);1H |
| InChIKey | BQKRYWJBPJGVBB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|