C20H30F3N5O — CID 111233927
N-[2-[[ethylamino-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methylidene]amino]ethyl]-2-methylpropanamide (PubChem CID 111233927) has the molecular formula C20H30F3N5O and a molecular weight of 413.49 g/mol. Its IUPAC name is N-[2-[[ethylamino-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methylidene]amino]ethyl]-2-methylpropanamide.
| Compound Name | N-[2-[[ethylamino-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methylidene]amino]ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 111233927 |
| Molecular Formula | C20H30F3N5O |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | N-[2-[[ethylamino-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methylidene]amino]ethyl]-2-methylpropanamide |
| SMILES | CCN/C(=N\CCNC(=O)C(C)C)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H30F3N5O/c1-4-24-19(26-9-8-25-18(29)15(2)3)28-12-10-27(11-13-28)17-7-5-6-16(14-17)20(21,22)23/h5-7,14-15H,4,8-13H2,1-3H3,(H,24,26)(H,25,29) |
| InChIKey | UASXUYWOSPUTGH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|