C22H31F3N6 — CID 111233989
N-ethyl-4-[3-(trifluoromethyl)phenyl]-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]piperazine-1-carboximidamide (PubChem CID 111233989) has the molecular formula C22H31F3N6 and a molecular weight of 436.53 g/mol. Its IUPAC name is N-ethyl-4-[3-(trifluoromethyl)phenyl]-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-[3-(trifluoromethyl)phenyl]-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111233989 |
| Molecular Formula | C22H31F3N6 |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | N-ethyl-4-[3-(trifluoromethyl)phenyl]-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1c(C)nn(C)c1C)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H31F3N6/c1-5-26-21(27-10-9-20-16(2)28-29(4)17(20)3)31-13-11-30(12-14-31)19-8-6-7-18(15-19)22(23,24)25/h6-8,15H,5,9-14H2,1-4H3,(H,26,27) |
| InChIKey | GIBXMXXEAIKBDL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|