C17H31N5 — CID 111210419
N-ethyl-4-methyl-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]piperidine-1-carboximidamide (PubChem CID 111210419) has the molecular formula C17H31N5 and a molecular weight of 305.47 g/mol. Its IUPAC name is N-ethyl-4-methyl-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]piperidine-1-carboximidamide.
| Compound Name | N-ethyl-4-methyl-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111210419 |
| Molecular Formula | C17H31N5 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.26 |
| IUPAC Name | N-ethyl-4-methyl-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1c(C)nn(C)c1C)N1CCC(C)CC1 |
| InChI | InChI=1S/C17H31N5/c1-6-18-17(22-11-8-13(2)9-12-22)19-10-7-16-14(3)20-21(5)15(16)4/h13H,6-12H2,1-5H3,(H,18,19) |
| InChIKey | MWGLLNLREIHXAQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|