C22H39N5O2 — CID 109449047
N-ethyl-4-(oxan-2-ylmethoxy)-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]piperidine-1-carboximidamide (PubChem CID 109449047) has the molecular formula C22H39N5O2 and a molecular weight of 405.59 g/mol. Its IUPAC name is N-ethyl-4-(oxan-2-ylmethoxy)-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]piperidine-1-carboximidamide.
| Compound Name | N-ethyl-4-(oxan-2-ylmethoxy)-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109449047 |
| Molecular Formula | C22H39N5O2 |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.31 |
| IUPAC Name | N-ethyl-4-(oxan-2-ylmethoxy)-N'-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1c(C)nn(C)c1C)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C22H39N5O2/c1-5-23-22(24-12-9-21-17(2)25-26(4)18(21)3)27-13-10-19(11-14-27)29-16-20-8-6-7-15-28-20/h19-20H,5-16H2,1-4H3,(H,23,24) |
| InChIKey | OHGKJNKVTWOXLQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 63.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|