C20H36N6O2 — CID 109446985
N-ethyl-N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 109446985) has the molecular formula C20H36N6O2 and a molecular weight of 392.55 g/mol. Its IUPAC name is N-ethyl-N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109446985 |
| Molecular Formula | C20H36N6O2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | N-ethyl-N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCn1cnnc1CC)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C20H36N6O2/c1-3-19-24-23-16-26(19)13-10-22-20(21-4-2)25-11-8-17(9-12-25)28-15-18-7-5-6-14-27-18/h16-18H,3-15H2,1-2H3,(H,21,22) |
| InChIKey | YVKJQKNWCFXHKS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 76.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|