C20H26F3IN4O2 — CID 111234140
N-ethyl-N'-[2-(furan-2-yl)-2-hydroxyethyl]-4-[3-(trifluoromethyl)phenyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111234140) has the molecular formula C20H26F3IN4O2 and a molecular weight of 538.35 g/mol. Its IUPAC name is N-ethyl-N'-[2-(furan-2-yl)-2-hydroxyethyl]-4-[3-(trifluoromethyl)phenyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[2-(furan-2-yl)-2-hydroxyethyl]-4-[3-(trifluoromethyl)phenyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111234140 |
| Molecular Formula | C20H26F3IN4O2 |
| Molecular Weight | 538.35 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | N-ethyl-N'-[2-(furan-2-yl)-2-hydroxyethyl]-4-[3-(trifluoromethyl)phenyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccco1)N1CCN(c2cccc(C(F)(F)F)c2)CC1.I |
| InChI | InChI=1S/C20H25F3N4O2.HI/c1-2-24-19(25-14-17(28)18-7-4-12-29-18)27-10-8-26(9-11-27)16-6-3-5-15(13-16)20(21,22)23;/h3-7,12-13,17,28H,2,8-11,14H2,1H3,(H,24,25);1H |
| InChIKey | WAJKPTVOJVFYEI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|