C18H25F3IN5O3 — CID 111164086
ethyl 4-[N-ethyl-N'-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111164086) has the molecular formula C18H25F3IN5O3 and a molecular weight of 543.33 g/mol. Its IUPAC name is ethyl 4-[N-ethyl-N'-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[N-ethyl-N'-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111164086 |
| Molecular Formula | C18H25F3IN5O3 |
| Molecular Weight | 543.33 g/mol |
| Exact Mass | 543.10 |
| IUPAC Name | ethyl 4-[N-ethyl-N'-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccc(F)c(F)c1F)N1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C18H24F3N5O3.HI/c1-3-22-17(25-7-9-26(10-8-25)18(28)29-4-2)23-11-14(27)24-13-6-5-12(19)15(20)16(13)21;/h5-6H,3-4,7-11H2,1-2H3,(H,22,23)(H,24,27);1H |
| InChIKey | PZJGHMJIYJIGRZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|