C16H20F3N3O3 — CID 109029204
ethyl 4-[3-oxo-3-(2,3,4-trifluoroanilino)propyl]piperazine-1-carboxylate (PubChem CID 109029204) has the molecular formula C16H20F3N3O3 and a molecular weight of 359.35 g/mol. Its IUPAC name is ethyl 4-[3-oxo-3-(2,3,4-trifluoroanilino)propyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-oxo-3-(2,3,4-trifluoroanilino)propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 109029204 |
| Molecular Formula | C16H20F3N3O3 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | ethyl 4-[3-oxo-3-(2,3,4-trifluoroanilino)propyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CCC(=O)Nc2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C16H20F3N3O3/c1-2-25-16(24)22-9-7-21(8-10-22)6-5-13(23)20-12-4-3-11(17)14(18)15(12)19/h3-4H,2,5-10H2,1H3,(H,20,23) |
| InChIKey | HRHQJGUVIYILOQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|