C20H29N3O7 — CID 171154401
ethyl 4-[3-(2,5-dimethylanilino)-3-oxopropyl]piperazine-1-carboxylate;oxalic acid (PubChem CID 171154401) has the molecular formula C20H29N3O7 and a molecular weight of 423.47 g/mol. Its IUPAC name is ethyl 4-[3-(2,5-dimethylanilino)-3-oxopropyl]piperazine-1-carboxylate;oxalic acid.
| Compound Name | ethyl 4-[3-(2,5-dimethylanilino)-3-oxopropyl]piperazine-1-carboxylate;oxalic acid |
|---|---|
| PubChem CID | 171154401 |
| Molecular Formula | C20H29N3O7 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | ethyl 4-[3-(2,5-dimethylanilino)-3-oxopropyl]piperazine-1-carboxylate;oxalic acid |
| SMILES | CCOC(=O)N1CCN(CCC(=O)Nc2cc(C)ccc2C)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H27N3O3.C2H2O4/c1-4-24-18(23)21-11-9-20(10-12-21)8-7-17(22)19-16-13-14(2)5-6-15(16)3;3-1(4)2(5)6/h5-6,13H,4,7-12H2,1-3H3,(H,19,22);(H,3,4)(H,5,6) |
| InChIKey | QGOVXIJWUGHZPP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 136.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|