C22H26F3N5O2 — CID 111133503
2-[[ethylamino-[4-(2-methoxyphenyl)piperazin-1-yl]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 111133503) has the molecular formula C22H26F3N5O2 and a molecular weight of 449.48 g/mol. Its IUPAC name is 2-[[ethylamino-[4-(2-methoxyphenyl)piperazin-1-yl]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[ethylamino-[4-(2-methoxyphenyl)piperazin-1-yl]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 111133503 |
| Molecular Formula | C22H26F3N5O2 |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 2-[[ethylamino-[4-(2-methoxyphenyl)piperazin-1-yl]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccc(F)c(F)c1F)N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C22H26F3N5O2/c1-3-26-22(27-14-19(31)28-16-9-8-15(23)20(24)21(16)25)30-12-10-29(11-13-30)17-6-4-5-7-18(17)32-2/h4-9H,3,10-14H2,1-2H3,(H,26,27)(H,28,31) |
| InChIKey | UIXURNICOSWDFT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|