C21H23F3N4O — CID 111723997
2-[[ethylamino-(3-phenylpyrrolidin-1-yl)methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 111723997) has the molecular formula C21H23F3N4O and a molecular weight of 404.44 g/mol. Its IUPAC name is 2-[[ethylamino-(3-phenylpyrrolidin-1-yl)methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[ethylamino-(3-phenylpyrrolidin-1-yl)methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 111723997 |
| Molecular Formula | C21H23F3N4O |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 2-[[ethylamino-(3-phenylpyrrolidin-1-yl)methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccc(F)c(F)c1F)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C21H23F3N4O/c1-2-25-21(28-11-10-15(13-28)14-6-4-3-5-7-14)26-12-18(29)27-17-9-8-16(22)19(23)20(17)24/h3-9,15H,2,10-13H2,1H3,(H,25,26)(H,27,29) |
| InChIKey | WVYXPZFCRRVXER-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|