C17H25F2N3 — CID 111740428
N'-[2-(2,6-difluorophenyl)ethyl]-N-ethyl-3,3-dimethylpyrrolidine-1-carboximidamide (PubChem CID 111740428) has the molecular formula C17H25F2N3 and a molecular weight of 309.40 g/mol. Its IUPAC name is N'-[2-(2,6-difluorophenyl)ethyl]-N-ethyl-3,3-dimethylpyrrolidine-1-carboximidamide.
| Compound Name | N'-[2-(2,6-difluorophenyl)ethyl]-N-ethyl-3,3-dimethylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111740428 |
| Molecular Formula | C17H25F2N3 |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | N'-[2-(2,6-difluorophenyl)ethyl]-N-ethyl-3,3-dimethylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1c(F)cccc1F)N1CCC(C)(C)C1 |
| InChI | InChI=1S/C17H25F2N3/c1-4-20-16(22-11-9-17(2,3)12-22)21-10-8-13-14(18)6-5-7-15(13)19/h5-7H,4,8-12H2,1-3H3,(H,20,21) |
| InChIKey | FEUKWADFCCSYQT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|