C19H31IN4O — CID 111739519
N-[2-[[(3,3-dimethylpyrrolidin-1-yl)-(ethylamino)methylidene]amino]ethyl]-3-methylbenzamide;hydroiodide (PubChem CID 111739519) has the molecular formula C19H31IN4O and a molecular weight of 458.39 g/mol. Its IUPAC name is N-[2-[[(3,3-dimethylpyrrolidin-1-yl)-(ethylamino)methylidene]amino]ethyl]-3-methylbenzamide;hydroiodide.
| Compound Name | N-[2-[[(3,3-dimethylpyrrolidin-1-yl)-(ethylamino)methylidene]amino]ethyl]-3-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111739519 |
| Molecular Formula | C19H31IN4O |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | N-[2-[[(3,3-dimethylpyrrolidin-1-yl)-(ethylamino)methylidene]amino]ethyl]-3-methylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)c1cccc(C)c1)N1CCC(C)(C)C1.I |
| InChI | InChI=1S/C19H30N4O.HI/c1-5-20-18(23-12-9-19(3,4)14-23)22-11-10-21-17(24)16-8-6-7-15(2)13-16;/h6-8,13H,5,9-12,14H2,1-4H3,(H,20,22)(H,21,24);1H |
| InChIKey | LULRUGDZYWCWPG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|