C19H30N4OS — CID 109487248
N-[2-[[ethylamino-(2-ethylthiomorpholin-4-yl)methylidene]amino]ethyl]-3-methylbenzamide (PubChem CID 109487248) has the molecular formula C19H30N4OS and a molecular weight of 362.54 g/mol. Its IUPAC name is N-[2-[[ethylamino-(2-ethylthiomorpholin-4-yl)methylidene]amino]ethyl]-3-methylbenzamide.
| Compound Name | N-[2-[[ethylamino-(2-ethylthiomorpholin-4-yl)methylidene]amino]ethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 109487248 |
| Molecular Formula | C19H30N4OS |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | N-[2-[[ethylamino-(2-ethylthiomorpholin-4-yl)methylidene]amino]ethyl]-3-methylbenzamide |
| SMILES | CCN/C(=N\CCNC(=O)c1cccc(C)c1)N1CCSC(CC)C1 |
| InChI | InChI=1S/C19H30N4OS/c1-4-17-14-23(11-12-25-17)19(20-5-2)22-10-9-21-18(24)16-8-6-7-15(3)13-16/h6-8,13,17H,4-5,9-12,14H2,1-3H3,(H,20,22)(H,21,24) |
| InChIKey | OHGSOEASJYHKHY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|