C19H32N4O2S — CID 111152474
4-benzyl-N-ethyl-N'-[2-(ethylsulfonylamino)ethyl]piperidine-1-carboximidamide (PubChem CID 111152474) has the molecular formula C19H32N4O2S and a molecular weight of 380.56 g/mol. Its IUPAC name is 4-benzyl-N-ethyl-N'-[2-(ethylsulfonylamino)ethyl]piperidine-1-carboximidamide.
| Compound Name | 4-benzyl-N-ethyl-N'-[2-(ethylsulfonylamino)ethyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111152474 |
| Molecular Formula | C19H32N4O2S |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 4-benzyl-N-ethyl-N'-[2-(ethylsulfonylamino)ethyl]piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCNS(=O)(=O)CC)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H32N4O2S/c1-3-20-19(21-12-13-22-26(24,25)4-2)23-14-10-18(11-15-23)16-17-8-6-5-7-9-17/h5-9,18,22H,3-4,10-16H2,1-2H3,(H,20,21) |
| InChIKey | JPMZCIMYNQKOMU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|