C17H29IN4O3 — CID 111156342
ethyl 1-[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111156342) has the molecular formula C17H29IN4O3 and a molecular weight of 464.35 g/mol. Its IUPAC name is ethyl 1-[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111156342 |
| Molecular Formula | C17H29IN4O3 |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | ethyl 1-[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C)c(C)o1)N1CCC(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C17H28N4O3.HI/c1-5-18-17(19-11-15-20-12(3)13(4)24-15)21-9-7-14(8-10-21)16(22)23-6-2;/h14H,5-11H2,1-4H3,(H,18,19);1H |
| InChIKey | HODYDQKEYSNVPS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|