C21H23FN6S — CID 19293480
N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-4-(pyridin-3-ylmethyl)piperazine-1-carbothioamide (PubChem CID 19293480) has the molecular formula C21H23FN6S and a molecular weight of 410.52 g/mol. Its IUPAC name is N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-4-(pyridin-3-ylmethyl)piperazine-1-carbothioamide.
| Compound Name | N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-4-(pyridin-3-ylmethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19293480 |
| Molecular Formula | C21H23FN6S |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-4-(pyridin-3-ylmethyl)piperazine-1-carbothioamide |
| SMILES | Fc1ccc(Cn2cc(NC(=S)N3CCN(Cc4cccnc4)CC3)cn2)cc1 |
| InChI | InChI=1S/C21H23FN6S/c22-19-5-3-17(4-6-19)15-28-16-20(13-24-28)25-21(29)27-10-8-26(9-11-27)14-18-2-1-7-23-12-18/h1-7,12-13,16H,8-11,14-15H2,(H,25,29) |
| InChIKey | JKCVCWFSVCJKTJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|