C18H29N5O2S — CID 175194066
tert-butyl 4-[2-(pyridin-3-ylmethylcarbamothioylamino)ethyl]piperazine-1-carboxylate (PubChem CID 175194066) has the molecular formula C18H29N5O2S and a molecular weight of 379.53 g/mol. Its IUPAC name is tert-butyl 4-[2-(pyridin-3-ylmethylcarbamothioylamino)ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(pyridin-3-ylmethylcarbamothioylamino)ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175194066 |
| Molecular Formula | C18H29N5O2S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | tert-butyl 4-[2-(pyridin-3-ylmethylcarbamothioylamino)ethyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCNC(=S)NCc2cccnc2)CC1 |
| InChI | InChI=1S/C18H29N5O2S/c1-18(2,3)25-17(24)23-11-9-22(10-12-23)8-7-20-16(26)21-14-15-5-4-6-19-13-15/h4-6,13H,7-12,14H2,1-3H3,(H2,20,21,26) |
| InChIKey | XYLRUCURVYOGHJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|