C14H17N3S — CID 61240401
N-[[4-(1H-pyrazol-5-yl)phenyl]methyl]thiolan-3-amine (PubChem CID 61240401) has the molecular formula C14H17N3S and a molecular weight of 259.38 g/mol. Its IUPAC name is N-[[4-(1H-pyrazol-5-yl)phenyl]methyl]thiolan-3-amine.
| Compound Name | N-[[4-(1H-pyrazol-5-yl)phenyl]methyl]thiolan-3-amine |
|---|---|
| PubChem CID | 61240401 |
| Molecular Formula | C14H17N3S |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | N-[[4-(1H-pyrazol-5-yl)phenyl]methyl]thiolan-3-amine |
| SMILES | c1cc(-c2ccc(CNC3CCSC3)cc2)[nH]n1 |
| InChI | InChI=1S/C14H17N3S/c1-3-12(14-5-7-16-17-14)4-2-11(1)9-15-13-6-8-18-10-13/h1-5,7,13,15H,6,8-10H2,(H,16,17) |
| InChIKey | FNBOUAGTWPVBRI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |