C16H28N2O3Si — CID 102179234
trans-(1R,2R)-2-N-[(4-trimethoxysilylphenyl)methyl]cyclohexane-1,2-diamine (PubChem CID 102179234) has the molecular formula C16H28N2O3Si and a molecular weight of 324.50 g/mol. Its IUPAC name is trans-(1R,2R)-2-N-[(4-trimethoxysilylphenyl)methyl]cyclohexane-1,2-diamine.
| Compound Name | trans-(1R,2R)-2-N-[(4-trimethoxysilylphenyl)methyl]cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 102179234 |
| Molecular Formula | C16H28N2O3Si |
| Molecular Weight | 324.50 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | trans-(1R,2R)-2-N-[(4-trimethoxysilylphenyl)methyl]cyclohexane-1,2-diamine |
| SMILES | CO[Si](OC)(OC)c1ccc(CN[C@@H]2CCCC[C@H]2N)cc1 |
| InChI | InChI=1S/C16H28N2O3Si/c1-19-22(20-2,21-3)14-10-8-13(9-11-14)12-18-16-7-5-4-6-15(16)17/h8-11,15-16,18H,4-7,12,17H2,1-3H3/t15-,16-/m1/s1 |
| InChIKey | ONTLDLIFXIEXJV-HZPDHXFCSA-N |
| XLogP | 1.13 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.50 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|