C13H18ClN3O2 — CID 90782417
4-[(6-chloro-3-pyridinyl)methylamino]-3-methylpiperidine-1-carboxylic acid (PubChem CID 90782417) has the molecular formula C13H18ClN3O2 and a molecular weight of 283.76 g/mol. Its IUPAC name is 4-[(6-chloro-3-pyridinyl)methylamino]-3-methylpiperidine-1-carboxylic acid.
| Compound Name | 4-[(6-chloro-3-pyridinyl)methylamino]-3-methylpiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 90782417 |
| Molecular Formula | C13H18ClN3O2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 4-[(6-chloro-3-pyridinyl)methylamino]-3-methylpiperidine-1-carboxylic acid |
| SMILES | CC1CN(C(=O)O)CCC1NCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C13H18ClN3O2/c1-9-8-17(13(18)19)5-4-11(9)15-6-10-2-3-12(14)16-7-10/h2-3,7,9,11,15H,4-6,8H2,1H3,(H,18,19) |
| InChIKey | LHVSFTVSTZTHRR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|