C20H22N2O5 — CID 113206816
4,5,6-trimethoxy-N-(2-methoxy-5-methylphenyl)-1H-indole-3-carboxamide (PubChem CID 113206816) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is 4,5,6-trimethoxy-N-(2-methoxy-5-methylphenyl)-1H-indole-3-carboxamide.
| Compound Name | 4,5,6-trimethoxy-N-(2-methoxy-5-methylphenyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 113206816 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 4,5,6-trimethoxy-N-(2-methoxy-5-methylphenyl)-1H-indole-3-carboxamide |
| SMILES | COc1ccc(C)cc1NC(=O)c1c[nH]c2cc(OC)c(OC)c(OC)c12 |
| InChI | InChI=1S/C20H22N2O5/c1-11-6-7-15(24-2)13(8-11)22-20(23)12-10-21-14-9-16(25-3)18(26-4)19(27-5)17(12)14/h6-10,21H,1-5H3,(H,22,23) |
| InChIKey | PCHPMOJBVJWBDT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |