C19H18N2O6 — CID 137464589
N-(3-hydroxyphenyl)-5,6,7-trimethoxy-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 137464589) has the molecular formula C19H18N2O6 and a molecular weight of 370.36 g/mol. Its IUPAC name is N-(3-hydroxyphenyl)-5,6,7-trimethoxy-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-(3-hydroxyphenyl)-5,6,7-trimethoxy-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 137464589 |
| Molecular Formula | C19H18N2O6 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N-(3-hydroxyphenyl)-5,6,7-trimethoxy-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | COc1cc2[nH]cc(C(=O)Nc3cccc(O)c3)c(=O)c2c(OC)c1OC |
| InChI | InChI=1S/C19H18N2O6/c1-25-14-8-13-15(18(27-3)17(14)26-2)16(23)12(9-20-13)19(24)21-10-5-4-6-11(22)7-10/h4-9,22H,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | GWHWJIDWURCCLC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 109.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |