C17H19BrN2O5 — CID 99788746
methyl (2S)-2-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propanoyl-methylamino]butanoate (PubChem CID 99788746) has the molecular formula C17H19BrN2O5 and a molecular weight of 411.25 g/mol. Its IUPAC name is methyl (2S)-2-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propanoyl-methylamino]butanoate.
| Compound Name | methyl (2S)-2-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propanoyl-methylamino]butanoate |
|---|---|
| PubChem CID | 99788746 |
| Molecular Formula | C17H19BrN2O5 |
| Molecular Weight | 411.25 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | methyl (2S)-2-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propanoyl-methylamino]butanoate |
| SMILES | CC[C@@H](C(=O)OC)N(C)C(=O)CCN1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C17H19BrN2O5/c1-4-13(17(24)25-3)19(2)14(21)7-8-20-15(22)11-6-5-10(18)9-12(11)16(20)23/h5-6,9,13H,4,7-8H2,1-3H3/t13-/m0/s1 |
| InChIKey | HUMBIBNYRNYCNA-ZDUSSCGKSA-N |
| XLogP | 1.85 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|