C21H21BrN2O4 — CID 27447917
3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-methyl-N-[2-(4-methylphenoxy)ethyl]propanamide (PubChem CID 27447917) has the molecular formula C21H21BrN2O4 and a molecular weight of 445.31 g/mol. Its IUPAC name is 3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-methyl-N-[2-(4-methylphenoxy)ethyl]propanamide.
| Compound Name | 3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-methyl-N-[2-(4-methylphenoxy)ethyl]propanamide |
|---|---|
| PubChem CID | 27447917 |
| Molecular Formula | C21H21BrN2O4 |
| Molecular Weight | 445.31 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-methyl-N-[2-(4-methylphenoxy)ethyl]propanamide |
| SMILES | Cc1ccc(OCCN(C)C(=O)CCN2C(=O)c3ccc(Br)cc3C2=O)cc1 |
| InChI | InChI=1S/C21H21BrN2O4/c1-14-3-6-16(7-4-14)28-12-11-23(2)19(25)9-10-24-20(26)17-8-5-15(22)13-18(17)21(24)27/h3-8,13H,9-12H2,1-2H3 |
| InChIKey | IBEGUBJPZCOIKQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|