C25H26N2O7S — CID 26004725
[(2S)-1-[[(3S)-1,1-dioxothiolan-3-yl]-ethylamino]-1-oxopropan-2-yl] 3-[(1,3-dioxoisoindol-2-yl)methyl]benzoate (PubChem CID 26004725) has the molecular formula C25H26N2O7S and a molecular weight of 498.56 g/mol. Its IUPAC name is [(2S)-1-[[(3S)-1,1-dioxothiolan-3-yl]-ethylamino]-1-oxopropan-2-yl] 3-[(1,3-dioxoisoindol-2-yl)methyl]benzoate.
| Compound Name | [(2S)-1-[[(3S)-1,1-dioxothiolan-3-yl]-ethylamino]-1-oxopropan-2-yl] 3-[(1,3-dioxoisoindol-2-yl)methyl]benzoate |
|---|---|
| PubChem CID | 26004725 |
| Molecular Formula | C25H26N2O7S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | [(2S)-1-[[(3S)-1,1-dioxothiolan-3-yl]-ethylamino]-1-oxopropan-2-yl] 3-[(1,3-dioxoisoindol-2-yl)methyl]benzoate |
| SMILES | CCN(C(=O)[C@H](C)OC(=O)c1cccc(CN2C(=O)c3ccccc3C2=O)c1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C25H26N2O7S/c1-3-26(19-11-12-35(32,33)15-19)22(28)16(2)34-25(31)18-8-6-7-17(13-18)14-27-23(29)20-9-4-5-10-21(20)24(27)30/h4-10,13,16,19H,3,11-12,14-15H2,1-2H3/t16-,19-/m0/s1 |
| InChIKey | BZFXRWQZGWNPFT-LPHOPBHVSA-N |
| XLogP | 2.06 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|