C26H28N2O8S — CID 2498030
[2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethoxybenzoate (PubChem CID 2498030) has the molecular formula C26H28N2O8S and a molecular weight of 528.58 g/mol. Its IUPAC name is [2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethoxybenzoate.
| Compound Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethoxybenzoate |
|---|---|
| PubChem CID | 2498030 |
| Molecular Formula | C26H28N2O8S |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethoxybenzoate |
| SMILES | CCOc1ccc(CN2C(=O)c3ccccc3C2=O)cc1C(=O)OCC(=O)N(CC)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C26H28N2O8S/c1-3-27(18-11-12-37(33,34)16-18)23(29)15-36-26(32)21-13-17(9-10-22(21)35-4-2)14-28-24(30)19-7-5-6-8-20(19)25(28)31/h5-10,13,18H,3-4,11-12,14-16H2,1-2H3/t18-/m1/s1 |
| InChIKey | YHTZXXJUOJHXBJ-GOSISDBHSA-N |
| XLogP | 2.07 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|