C17H21N3O3S — CID 108886793
1-(1,1-dioxothiolan-3-yl)-1-ethyl-3-(4-pyrrol-1-ylphenyl)urea (PubChem CID 108886793) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-1-ethyl-3-(4-pyrrol-1-ylphenyl)urea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-1-ethyl-3-(4-pyrrol-1-ylphenyl)urea |
|---|---|
| PubChem CID | 108886793 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-1-ethyl-3-(4-pyrrol-1-ylphenyl)urea |
| SMILES | CCN(C(=O)Nc1ccc(-n2cccc2)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H21N3O3S/c1-2-20(16-9-12-24(22,23)13-16)17(21)18-14-5-7-15(8-6-14)19-10-3-4-11-19/h3-8,10-11,16H,2,9,12-13H2,1H3,(H,18,21) |
| InChIKey | WKMMOHBYDWVBLU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |