C25H24N4O3 — CID 135953948
N-[2-(4-methoxyphenyl)ethyl]-2-[(4-oxo-3H-quinazolin-2-yl)methylamino]benzamide (PubChem CID 135953948) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)ethyl]-2-[(4-oxo-3H-quinazolin-2-yl)methylamino]benzamide.
| Compound Name | N-[2-(4-methoxyphenyl)ethyl]-2-[(4-oxo-3H-quinazolin-2-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 135953948 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | N-[2-(4-methoxyphenyl)ethyl]-2-[(4-oxo-3H-quinazolin-2-yl)methylamino]benzamide |
| SMILES | COc1ccc(CCNC(=O)c2ccccc2NCc2nc3ccccc3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C25H24N4O3/c1-32-18-12-10-17(11-13-18)14-15-26-24(30)19-6-2-4-8-21(19)27-16-23-28-22-9-5-3-7-20(22)25(31)29-23/h2-13,27H,14-16H2,1H3,(H,26,30)(H,28,29,31) |
| InChIKey | XWSGHBSKPSKTGB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |