C19H23N3O — CID 145043426
(Z)-2-[2-[(4-methoxyphenyl)methylamino]phenyl]pent-2-enimidamide (PubChem CID 145043426) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is (Z)-2-[2-[(4-methoxyphenyl)methylamino]phenyl]pent-2-enimidamide.
| Compound Name | (Z)-2-[2-[(4-methoxyphenyl)methylamino]phenyl]pent-2-enimidamide |
|---|---|
| PubChem CID | 145043426 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | (Z)-2-[2-[(4-methoxyphenyl)methylamino]phenyl]pent-2-enimidamide |
| SMILES | [H]/N=C(N)/C(=C\CC)c1ccccc1NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C19H23N3O/c1-3-6-17(19(20)21)16-7-4-5-8-18(16)22-13-14-9-11-15(23-2)12-10-14/h4-12,22H,3,13H2,1-2H3,(H3,20,21)/b17-6- |
| InChIKey | XLPQGZKGORRCIQ-FMQZQXMHSA-N |
| XLogP | 4.04 |
| TPSA | 71.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|