C15H16ClN3O2 — CID 82253623
4-[(2-carbamimidoylanilino)methyl]benzoic acid;hydrochloride (PubChem CID 82253623) has the molecular formula C15H16ClN3O2 and a molecular weight of 305.77 g/mol. Its IUPAC name is 4-[(2-carbamimidoylanilino)methyl]benzoic acid;hydrochloride.
| Compound Name | 4-[(2-carbamimidoylanilino)methyl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 82253623 |
| Molecular Formula | C15H16ClN3O2 |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 4-[(2-carbamimidoylanilino)methyl]benzoic acid;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccccc1NCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C15H15N3O2.ClH/c16-14(17)12-3-1-2-4-13(12)18-9-10-5-7-11(8-6-10)15(19)20;/h1-8,18H,9H2,(H3,16,17)(H,19,20);1H |
| InChIKey | SQJBVHWWCMSIKK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 99.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|